C12H15BrF2N2O2 — CID 119313649
4-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]butanamide (PubChem CID 119313649) has the molecular formula C12H15BrF2N2O2 and a molecular weight of 337.16 g/mol. Its IUPAC name is 4-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]butanamide.
| Compound Name | 4-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 119313649 |
| Molecular Formula | C12H15BrF2N2O2 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 4-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]butanamide |
| SMILES | NCCCC(=O)NCc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C12H15BrF2N2O2/c13-9-3-4-10(19-12(14)15)8(6-9)7-17-11(18)2-1-5-16/h3-4,6,12H,1-2,5,7,16H2,(H,17,18) |
| InChIKey | IJOPHDZNXRVMPM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |