C15H19BrF2N2O3 — CID 120930060
4-(aminomethyl)-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]oxane-4-carboxamide (PubChem CID 120930060) has the molecular formula C15H19BrF2N2O3 and a molecular weight of 393.23 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120930060 |
| Molecular Formula | C15H19BrF2N2O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 4-(aminomethyl)-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]oxane-4-carboxamide |
| SMILES | NCC1(C(=O)NCc2cc(Br)ccc2OC(F)F)CCOCC1 |
| InChI | InChI=1S/C15H19BrF2N2O3/c16-11-1-2-12(23-14(17)18)10(7-11)8-20-13(21)15(9-19)3-5-22-6-4-15/h1-2,7,14H,3-6,8-9,19H2,(H,20,21) |
| InChIKey | GLXKRYPIHUVWOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |