C14H18BrF2NO3 — CID 78928486
4-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]oxan-4-ol (PubChem CID 78928486) has the molecular formula C14H18BrF2NO3 and a molecular weight of 366.20 g/mol. Its IUPAC name is 4-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 78928486 |
| Molecular Formula | C14H18BrF2NO3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]oxan-4-ol |
| SMILES | OC1(CNCc2cc(Br)ccc2OC(F)F)CCOCC1 |
| InChI | InChI=1S/C14H18BrF2NO3/c15-11-1-2-12(21-13(16)17)10(7-11)8-18-9-14(19)3-5-20-6-4-14/h1-2,7,13,18-19H,3-6,8-9H2 |
| InChIKey | KZNIKYBHTQXVDZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |