C11H14BrF2NO2 — CID 43220291
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 43220291) has the molecular formula C11H14BrF2NO2 and a molecular weight of 310.14 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 43220291 |
| Molecular Formula | C11H14BrF2NO2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C11H14BrF2NO2/c1-16-5-4-15-7-8-6-9(12)2-3-10(8)17-11(13)14/h2-3,6,11,15H,4-5,7H2,1H3 |
| InChIKey | LCHHWLXCMPGCCQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|