C13H15BrF2N2O — CID 119115180
5-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]pentanenitrile (PubChem CID 119115180) has the molecular formula C13H15BrF2N2O and a molecular weight of 333.18 g/mol. Its IUPAC name is 5-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]pentanenitrile.
| Compound Name | 5-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]pentanenitrile |
|---|---|
| PubChem CID | 119115180 |
| Molecular Formula | C13H15BrF2N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]pentanenitrile |
| SMILES | N#CCCCCNCc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C13H15BrF2N2O/c14-11-4-5-12(19-13(15)16)10(8-11)9-18-7-3-1-2-6-17/h4-5,8,13,18H,1-3,7,9H2 |
| InChIKey | JHXPLJPZQFEINU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|