C12H12BrF2N3O2 — CID 103744520
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103744520) has the molecular formula C12H12BrF2N3O2 and a molecular weight of 348.15 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103744520 |
| Molecular Formula | C12H12BrF2N3O2 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | FC(F)Oc1ccc(Br)cc1CNCCc1ncno1 |
| InChI | InChI=1S/C12H12BrF2N3O2/c13-9-1-2-10(19-12(14)15)8(5-9)6-16-4-3-11-17-7-18-20-11/h1-2,5,7,12,16H,3-4,6H2 |
| InChIKey | PGRLJZAFKFCQJS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|