C15H15BrF2N2O — CID 43220642
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-2-ylethanamine (PubChem CID 43220642) has the molecular formula C15H15BrF2N2O and a molecular weight of 357.20 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-2-ylethanamine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 43220642 |
| Molecular Formula | C15H15BrF2N2O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-2-ylethanamine |
| SMILES | FC(F)Oc1ccc(Br)cc1CNCCc1ccccn1 |
| InChI | InChI=1S/C15H15BrF2N2O/c16-12-4-5-14(21-15(17)18)11(9-12)10-19-8-6-13-3-1-2-7-20-13/h1-5,7,9,15,19H,6,8,10H2 |
| InChIKey | YEMRIVFEUSSNMO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|