C15H16Br2N2O — CID 43220632
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-pyridin-2-ylethanamine (PubChem CID 43220632) has the molecular formula C15H16Br2N2O and a molecular weight of 400.11 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-pyridin-2-ylethanamine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 43220632 |
| Molecular Formula | C15H16Br2N2O |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-pyridin-2-ylethanamine |
| SMILES | COc1c(Br)cc(Br)cc1CNCCc1ccccn1 |
| InChI | InChI=1S/C15H16Br2N2O/c1-20-15-11(8-12(16)9-14(15)17)10-18-7-5-13-4-2-3-6-19-13/h2-4,6,8-9,18H,5,7,10H2,1H3 |
| InChIKey | FBZKESIQDGOKOM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|