C14H17Br2N3O — CID 104626755
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 104626755) has the molecular formula C14H17Br2N3O and a molecular weight of 403.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104626755 |
| Molecular Formula | C14H17Br2N3O |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | COc1c(Br)cc(Br)cc1CNCCc1ccn(C)n1 |
| InChI | InChI=1S/C14H17Br2N3O/c1-19-6-4-12(18-19)3-5-17-9-10-7-11(15)8-13(16)14(10)20-2/h4,6-8,17H,3,5,9H2,1-2H3 |
| InChIKey | MUWDRLLMGRLDQC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|