C14H19N5 — CID 104626788
1,5-dimethyl-4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]pyrrole-2-carbonitrile (PubChem CID 104626788) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 104626788 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1,5-dimethyl-4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(CNCCc2ccn(C)n2)cc(C#N)n1C |
| InChI | InChI=1S/C14H19N5/c1-11-12(8-14(9-15)19(11)3)10-16-6-4-13-5-7-18(2)17-13/h5,7-8,16H,4,6,10H2,1-3H3 |
| InChIKey | YCEUYUNMHGXDNS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|