C12H15N3 — CID 115866355
4-[(but-2-ynylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 115866355) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-[(but-2-ynylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(but-2-ynylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 115866355 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-[(but-2-ynylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | CC#CCNCc1cc(C#N)n(C)c1C |
| InChI | InChI=1S/C12H15N3/c1-4-5-6-14-9-11-7-12(8-13)15(3)10(11)2/h7,14H,6,9H2,1-3H3 |
| InChIKey | KJUGEOKUSCSHKS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|