C9H13N3 — CID 106104362
N-[2-(1-methylpyrazol-3-yl)ethyl]prop-2-yn-1-amine (PubChem CID 106104362) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[2-(1-methylpyrazol-3-yl)ethyl]prop-2-yn-1-amine.
| Compound Name | N-[2-(1-methylpyrazol-3-yl)ethyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 106104362 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-[2-(1-methylpyrazol-3-yl)ethyl]prop-2-yn-1-amine |
| SMILES | C#CCNCCc1ccn(C)n1 |
| InChI | InChI=1S/C9H13N3/c1-3-6-10-7-4-9-5-8-12(2)11-9/h1,5,8,10H,4,6-7H2,2H3 |
| InChIKey | BRMOKIIWXBCRDT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|