C9H17N3O2 — CID 106104702
(2S)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propane-1,2-diol (PubChem CID 106104702) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 106104702 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (2S)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propane-1,2-diol |
| SMILES | Cn1ccc(CCNC[C@H](O)CO)n1 |
| InChI | InChI=1S/C9H17N3O2/c1-12-5-3-8(11-12)2-4-10-6-9(14)7-13/h3,5,9-10,13-14H,2,4,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | FXARZUSPLOYEPJ-VIFPVBQESA-N |
| XLogP | -1.09 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|