C12H21N3O3 — CID 114144039
ethyl 3-hydroxy-4-[2-(1-methylpyrazol-3-yl)ethylamino]butanoate (PubChem CID 114144039) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[2-(1-methylpyrazol-3-yl)ethylamino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[2-(1-methylpyrazol-3-yl)ethylamino]butanoate |
|---|---|
| PubChem CID | 114144039 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | ethyl 3-hydroxy-4-[2-(1-methylpyrazol-3-yl)ethylamino]butanoate |
| SMILES | CCOC(=O)CC(O)CNCCc1ccn(C)n1 |
| InChI | InChI=1S/C12H21N3O3/c1-3-18-12(17)8-11(16)9-13-6-4-10-5-7-15(2)14-10/h5,7,11,13,16H,3-4,6,8-9H2,1-2H3 |
| InChIKey | XFXTVRQYZHZHOB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|