C12H19NO3S — CID 103235530
ethyl 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoate (PubChem CID 103235530) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoate.
| Compound Name | ethyl 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoate |
|---|---|
| PubChem CID | 103235530 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | ethyl 3-hydroxy-4-(2-thiophen-2-ylethylamino)butanoate |
| SMILES | CCOC(=O)CC(O)CNCCc1cccs1 |
| InChI | InChI=1S/C12H19NO3S/c1-2-16-12(15)8-10(14)9-13-6-5-11-4-3-7-17-11/h3-4,7,10,13-14H,2,5-6,8-9H2,1H3 |
| InChIKey | ZQGPFHVQRREZIP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|