C12H19NO4S — CID 54937741
ethyl 2-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]acetate (PubChem CID 54937741) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is ethyl 2-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]acetate.
| Compound Name | ethyl 2-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]acetate |
|---|---|
| PubChem CID | 54937741 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl 2-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]acetate |
| SMILES | CCOC(=O)CNCC(O)COCc1cccs1 |
| InChI | InChI=1S/C12H19NO4S/c1-2-17-12(15)7-13-6-10(14)8-16-9-11-4-3-5-18-11/h3-5,10,13-14H,2,6-9H2,1H3 |
| InChIKey | QYGCOTFEIZGKBS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |