C12H21NO2S2 — CID 63966458
1-(3-methylsulfanylpropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 63966458) has the molecular formula C12H21NO2S2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(3-methylsulfanylpropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 63966458 |
| Molecular Formula | C12H21NO2S2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-(3-methylsulfanylpropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CSCCCNCC(O)COCc1cccs1 |
| InChI | InChI=1S/C12H21NO2S2/c1-16-6-3-5-13-8-11(14)9-15-10-12-4-2-7-17-12/h2,4,7,11,13-14H,3,5-6,8-10H2,1H3 |
| InChIKey | GVENHJXCXXLINS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|