C14H25NO3S — CID 2119639
(2R)-1-(3-propan-2-yloxypropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 2119639) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is (2R)-1-(3-propan-2-yloxypropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-(3-propan-2-yloxypropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 2119639 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2R)-1-(3-propan-2-yloxypropylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CC(C)OCCCNC[C@@H](O)COCc1cccs1 |
| InChI | InChI=1S/C14H25NO3S/c1-12(2)18-7-4-6-15-9-13(16)10-17-11-14-5-3-8-19-14/h3,5,8,12-13,15-16H,4,6-7,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | NQLMAOBYIXPPIN-CYBMUJFWSA-N |
| XLogP | 2.03 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|