C15H27NO3S — CID 106285514
3-ethyl-1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]pentan-2-ol (PubChem CID 106285514) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 3-ethyl-1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]pentan-2-ol.
| Compound Name | 3-ethyl-1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 106285514 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-ethyl-1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]pentan-2-ol |
| SMILES | CCC(CC)C(O)CNCC(O)COCc1cccs1 |
| InChI | InChI=1S/C15H27NO3S/c1-3-12(4-2)15(18)9-16-8-13(17)10-19-11-14-6-5-7-20-14/h5-7,12-13,15-18H,3-4,8-11H2,1-2H3 |
| InChIKey | IMVOYZZKMBMEQJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |