C15H27NO3S — CID 106115240
3-[[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]methyl]hexan-1-ol (PubChem CID 106115240) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 3-[[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]methyl]hexan-1-ol.
| Compound Name | 3-[[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106115240 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCC(O)COCc1cccs1 |
| InChI | InChI=1S/C15H27NO3S/c1-2-4-13(6-7-17)9-16-10-14(18)11-19-12-15-5-3-8-20-15/h3,5,8,13-14,16-18H,2,4,6-7,9-12H2,1H3 |
| InChIKey | SSLKCYQKCSMSSB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |