C14H25NO3S — CID 61171076
1-(2-butoxyethylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 61171076) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-(2-butoxyethylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(2-butoxyethylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 61171076 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-(2-butoxyethylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CCCCOCCNCC(O)COCc1cccs1 |
| InChI | InChI=1S/C14H25NO3S/c1-2-3-7-17-8-6-15-10-13(16)11-18-12-14-5-4-9-19-14/h4-5,9,13,15-16H,2-3,6-8,10-12H2,1H3 |
| InChIKey | SIYVGOOJWWERSP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|