C13H23NO2S — CID 60634664
1-(pentan-2-ylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 60634664) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(pentan-2-ylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(pentan-2-ylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60634664 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(pentan-2-ylamino)-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CCCC(C)NCC(O)COCc1cccs1 |
| InChI | InChI=1S/C13H23NO2S/c1-3-5-11(2)14-8-12(15)9-16-10-13-6-4-7-17-13/h4,6-7,11-12,14-15H,3,5,8-10H2,1-2H3 |
| InChIKey | CPSOXQDOUUVISH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |