C11H19N3O4 — CID 106419650
ethyl 3-hydroxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]butanoate (PubChem CID 106419650) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]butanoate |
|---|---|
| PubChem CID | 106419650 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | ethyl 3-hydroxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]butanoate |
| SMILES | CCOC(=O)CC(O)CNCCc1nc(C)no1 |
| InChI | InChI=1S/C11H19N3O4/c1-3-17-11(16)6-9(15)7-12-5-4-10-13-8(2)14-18-10/h9,12,15H,3-7H2,1-2H3 |
| InChIKey | HKPRXGBRGOUQRN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|