C11H19N3O3 — CID 106416401
butyl 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]acetate (PubChem CID 106416401) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is butyl 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]acetate.
| Compound Name | butyl 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]acetate |
|---|---|
| PubChem CID | 106416401 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | butyl 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]acetate |
| SMILES | CCCCOC(=O)CNCCc1nc(C)no1 |
| InChI | InChI=1S/C11H19N3O3/c1-3-4-7-16-11(15)8-12-6-5-10-13-9(2)14-17-10/h12H,3-8H2,1-2H3 |
| InChIKey | COHURROONBGMDY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|