About propyl 2-(butylamino)acetate
propyl 2-(butylamino)acetate (PubChem CID 118604269) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is propyl 2-(butylamino)acetate.
Molecular Properties
| Compound Name | propyl 2-(butylamino)acetate |
| PubChem CID | 118604269 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | propyl 2-(butylamino)acetate |
| SMILES | CCCCNCC(=O)OCCC |
| InChI | InChI=1S/C9H19NO2/c1-3-5-6-10-8-9(11)12-7-4-2/h10H,3-8H2,1-2H3 |
| InChIKey | WQZXUZAMISRYFH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-(butylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(butylamino)acetate?
The IUPAC name of propyl 2-(butylamino)acetate (CID 118604269) is propyl 2-(butylamino)acetate.
What is the SMILES notation for propyl 2-(butylamino)acetate?
The canonical SMILES for propyl 2-(butylamino)acetate is CCCCNCC(=O)OCCC.
What is the InChIKey of propyl 2-(butylamino)acetate?
The InChIKey is WQZXUZAMISRYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-5-6-10-8-9(11)12-7-4-2/h10H,3-8H2,1-2H3.
What are the key properties of propyl 2-(butylamino)acetate?
propyl 2-(butylamino)acetate has a molecular weight of 173.26 g/mol, XLogP of 1.33, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(butylamino)acetate is sourced from PubChem (CID 118604269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).