About hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+)
hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) (PubChem CID 173091928) has the molecular formula C6H11O4Rb
and a molecular weight of 232.62 g/mol. Its IUPAC name is hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+).
Molecular Properties
| Compound Name | hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) |
| PubChem CID | 173091928 |
| Molecular Formula | C6H11O4Rb |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) |
| SMILES | CCCOC(=O)CC(=O)O.[H-].[Rb+] |
| InChI | InChI=1S/C6H10O4.Rb.H/c1-2-3-10-6(9)4-5(7)8;;/h2-4H2,1H3,(H,7,8);;/q;+1;-1 |
| InChIKey | YGORHEDINQBSJK-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+)?
The IUPAC name of hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) (CID 173091928) is hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+).
What is the SMILES notation for hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+)?
The canonical SMILES for hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) is CCCOC(=O)CC(=O)O.[H-].[Rb+].
What is the InChIKey of hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+)?
The InChIKey is YGORHEDINQBSJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.Rb.H/c1-2-3-10-6(9)4-5(7)8;;/h2-4H2,1H3,(H,7,8);;/q;+1;-1.
What are the key properties of hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+)?
hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) has a molecular weight of 232.62 g/mol, XLogP of -2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;3-oxo-3-propoxypropanoic acid;rubidium(1+) is sourced from PubChem (CID 173091928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).