About potassium;dipropyl 2-oxobutanedioate;hydride
potassium;dipropyl 2-oxobutanedioate;hydride (PubChem CID 173344043) has the molecular formula C10H17KO5
and a molecular weight of 256.34 g/mol. Its IUPAC name is potassium;dipropyl 2-oxobutanedioate;hydride.
Molecular Properties
| Compound Name | potassium;dipropyl 2-oxobutanedioate;hydride |
| PubChem CID | 173344043 |
| Molecular Formula | C10H17KO5 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | potassium;dipropyl 2-oxobutanedioate;hydride |
| SMILES | CCCOC(=O)CC(=O)C(=O)OCCC.[H-].[K+] |
| InChI | InChI=1S/C10H16O5.K.H/c1-3-5-14-9(12)7-8(11)10(13)15-6-4-2;;/h3-7H2,1-2H3;;/q;+1;-1 |
| InChIKey | JPOAKZQTQUAOGY-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze potassium;dipropyl 2-oxobutanedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;dipropyl 2-oxobutanedioate;hydride?
The IUPAC name of potassium;dipropyl 2-oxobutanedioate;hydride (CID 173344043) is potassium;dipropyl 2-oxobutanedioate;hydride.
What is the SMILES notation for potassium;dipropyl 2-oxobutanedioate;hydride?
The canonical SMILES for potassium;dipropyl 2-oxobutanedioate;hydride is CCCOC(=O)CC(=O)C(=O)OCCC.[H-].[K+].
What is the InChIKey of potassium;dipropyl 2-oxobutanedioate;hydride?
The InChIKey is JPOAKZQTQUAOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5.K.H/c1-3-5-14-9(12)7-8(11)10(13)15-6-4-2;;/h3-7H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;dipropyl 2-oxobutanedioate;hydride?
potassium;dipropyl 2-oxobutanedioate;hydride has a molecular weight of 256.34 g/mol, XLogP of -2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;dipropyl 2-oxobutanedioate;hydride is sourced from PubChem (CID 173344043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).