About sodium propyl 2,4-dioxopentanoate
sodium propyl 2,4-dioxopentanoate (PubChem CID 91996636) has the molecular formula C8H12NaO4+
and a molecular weight of 195.17 g/mol. Its IUPAC name is sodium propyl 2,4-dioxopentanoate.
Molecular Properties
| Compound Name | sodium propyl 2,4-dioxopentanoate |
| PubChem CID | 91996636 |
| Molecular Formula | C8H12NaO4+ |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | sodium propyl 2,4-dioxopentanoate |
| SMILES | CCCOC(=O)C(=O)CC(C)=O.[Na+] |
| InChI | InChI=1S/C8H12O4.Na/c1-3-4-12-8(11)7(10)5-6(2)9;/h3-5H2,1-2H3;/q;+1 |
| InChIKey | FIPAEIKICUHMCQ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium propyl 2,4-dioxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium propyl 2,4-dioxopentanoate?
The IUPAC name of sodium propyl 2,4-dioxopentanoate (CID 91996636) is sodium propyl 2,4-dioxopentanoate.
What is the SMILES notation for sodium propyl 2,4-dioxopentanoate?
The canonical SMILES for sodium propyl 2,4-dioxopentanoate is CCCOC(=O)C(=O)CC(C)=O.[Na+].
What is the InChIKey of sodium propyl 2,4-dioxopentanoate?
The InChIKey is FIPAEIKICUHMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4.Na/c1-3-4-12-8(11)7(10)5-6(2)9;/h3-5H2,1-2H3;/q;+1.
What are the key properties of sodium propyl 2,4-dioxopentanoate?
sodium propyl 2,4-dioxopentanoate has a molecular weight of 195.17 g/mol, XLogP of -2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium propyl 2,4-dioxopentanoate is sourced from PubChem (CID 91996636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).