About hydrazine;2-oxo-2-propoxyacetate
hydrazine;2-oxo-2-propoxyacetate (PubChem CID 22449370) has the molecular formula C5H11N2O4-
and a molecular weight of 163.15 g/mol. Its IUPAC name is hydrazine;2-oxo-2-propoxyacetate.
Molecular Properties
| Compound Name | hydrazine;2-oxo-2-propoxyacetate |
| PubChem CID | 22449370 |
| Molecular Formula | C5H11N2O4- |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | hydrazine;2-oxo-2-propoxyacetate |
| SMILES | CCCOC(=O)C(=O)[O-].NN |
| InChI | InChI=1S/C5H8O4.H4N2/c1-2-3-9-5(8)4(6)7;1-2/h2-3H2,1H3,(H,6,7);1-2H2/p-1 |
| InChIKey | YPHNSMTZBLKGAF-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;2-oxo-2-propoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;2-oxo-2-propoxyacetate?
The IUPAC name of hydrazine;2-oxo-2-propoxyacetate (CID 22449370) is hydrazine;2-oxo-2-propoxyacetate.
What is the SMILES notation for hydrazine;2-oxo-2-propoxyacetate?
The canonical SMILES for hydrazine;2-oxo-2-propoxyacetate is CCCOC(=O)C(=O)[O-].NN.
What is the InChIKey of hydrazine;2-oxo-2-propoxyacetate?
The InChIKey is YPHNSMTZBLKGAF-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O4.H4N2/c1-2-3-9-5(8)4(6)7;1-2/h2-3H2,1H3,(H,6,7);1-2H2/p-1.
What are the key properties of hydrazine;2-oxo-2-propoxyacetate?
hydrazine;2-oxo-2-propoxyacetate has a molecular weight of 163.15 g/mol, XLogP of -2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;2-oxo-2-propoxyacetate is sourced from PubChem (CID 22449370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).