About calcium propyl carbonate
calcium propyl carbonate (PubChem CID 158672692) has the molecular formula C8H14CaO6
and a molecular weight of 246.27 g/mol. Its IUPAC name is calcium propyl carbonate.
Molecular Properties
| Compound Name | calcium propyl carbonate |
| PubChem CID | 158672692 |
| Molecular Formula | C8H14CaO6 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | calcium propyl carbonate |
| SMILES | CCCOC(=O)[O-].CCCOC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C4H8O3.Ca/c2*1-2-3-7-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | IEDIYGZYKPFCQD-UHFFFAOYSA-L |
| XLogP | -0.87 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze calcium propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium propyl carbonate?
The IUPAC name of calcium propyl carbonate (CID 158672692) is calcium propyl carbonate.
What is the SMILES notation for calcium propyl carbonate?
The canonical SMILES for calcium propyl carbonate is CCCOC(=O)[O-].CCCOC(=O)[O-].[Ca+2].
What is the InChIKey of calcium propyl carbonate?
The InChIKey is IEDIYGZYKPFCQD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O3.Ca/c2*1-2-3-7-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium propyl carbonate?
calcium propyl carbonate has a molecular weight of 246.27 g/mol, XLogP of -0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium propyl carbonate is sourced from PubChem (CID 158672692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).