About dilithium;4-carboxylatooxybutyl carbonate
dilithium;4-carboxylatooxybutyl carbonate (PubChem CID 101151816) has the molecular formula C6H8Li2O6
and a molecular weight of 190.01 g/mol. Its IUPAC name is dilithium;4-carboxylatooxybutyl carbonate.
Molecular Properties
| Compound Name | dilithium;4-carboxylatooxybutyl carbonate |
| PubChem CID | 101151816 |
| Molecular Formula | C6H8Li2O6 |
| Molecular Weight | 190.01 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | dilithium;4-carboxylatooxybutyl carbonate |
| SMILES | O=C([O-])OCCCCOC(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C6H10O6.2Li/c7-5(8)11-3-1-2-4-12-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | MSOUEVZQCSKVCE-UHFFFAOYSA-L |
| XLogP | -7.51 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.01 |
| LogP ≤ 5 | -7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dilithium;4-carboxylatooxybutyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;4-carboxylatooxybutyl carbonate?
The IUPAC name of dilithium;4-carboxylatooxybutyl carbonate (CID 101151816) is dilithium;4-carboxylatooxybutyl carbonate.
What is the SMILES notation for dilithium;4-carboxylatooxybutyl carbonate?
The canonical SMILES for dilithium;4-carboxylatooxybutyl carbonate is O=C([O-])OCCCCOC(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;4-carboxylatooxybutyl carbonate?
The InChIKey is MSOUEVZQCSKVCE-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O6.2Li/c7-5(8)11-3-1-2-4-12-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2.
What are the key properties of dilithium;4-carboxylatooxybutyl carbonate?
dilithium;4-carboxylatooxybutyl carbonate has a molecular weight of 190.01 g/mol, XLogP of -7.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;4-carboxylatooxybutyl carbonate is sourced from PubChem (CID 101151816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).