About dioctyltin(2+);bis(6-hexoxyhexyl carbonate)
dioctyltin(2+);bis(6-hexoxyhexyl carbonate) (PubChem CID 159316790) has the molecular formula C42H84O8Sn
and a molecular weight of 835.84 g/mol. Its IUPAC name is dioctyltin(2+);bis(6-hexoxyhexyl carbonate).
Molecular Properties
| Compound Name | dioctyltin(2+);bis(6-hexoxyhexyl carbonate) |
| PubChem CID | 159316790 |
| Molecular Formula | C42H84O8Sn |
| Molecular Weight | 835.84 g/mol |
| Exact Mass | 836.52 |
| IUPAC Name | dioctyltin(2+);bis(6-hexoxyhexyl carbonate) |
| SMILES | CCCCCCCC[Sn+2]CCCCCCCC.CCCCCCOCCCCCCOC(=O)[O-].CCCCCCOCCCCCCOC(=O)[O-] |
| InChI | InChI=1S/2C13H26O4.2C8H17.Sn/c2*1-2-3-4-7-10-16-11-8-5-6-9-12-17-13(14)15;2*1-3-5-7-8-6-4-2;/h2*2-12H2,1H3,(H,14,15);2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | LDFWEFAWXPYGQN-UHFFFAOYSA-L |
| XLogP | 11.26 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 835.84 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin(2+);bis(6-hexoxyhexyl carbonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin(2+);bis(6-hexoxyhexyl carbonate)?
The IUPAC name of dioctyltin(2+);bis(6-hexoxyhexyl carbonate) (CID 159316790) is dioctyltin(2+);bis(6-hexoxyhexyl carbonate).
What is the SMILES notation for dioctyltin(2+);bis(6-hexoxyhexyl carbonate)?
The canonical SMILES for dioctyltin(2+);bis(6-hexoxyhexyl carbonate) is CCCCCCCC[Sn+2]CCCCCCCC.CCCCCCOCCCCCCOC(=O)[O-].CCCCCCOCCCCCCOC(=O)[O-].
What is the InChIKey of dioctyltin(2+);bis(6-hexoxyhexyl carbonate)?
The InChIKey is LDFWEFAWXPYGQN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H26O4.2C8H17.Sn/c2*1-2-3-4-7-10-16-11-8-5-6-9-12-17-13(14)15;2*1-3-5-7-8-6-4-2;/h2*2-12H2,1H3,(H,14,15);2*1,3-8H2,2H3;/q;;;;+2/p-2.
What are the key properties of dioctyltin(2+);bis(6-hexoxyhexyl carbonate)?
dioctyltin(2+);bis(6-hexoxyhexyl carbonate) has a molecular weight of 835.84 g/mol, XLogP of 11.26, 38 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+);bis(6-hexoxyhexyl carbonate) is sourced from PubChem (CID 159316790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).