dioctyltin(2+);bis(5-pentoxypentyl carbonate)

C38H76O8Sn — CID 160556550

IUPACdioctyltin(2+);bis(5-pentoxypentyl carbonate)
SMILESCCCCCCCC[Sn+2]CCCCCCCC.CCCCCOCCCCCOC(=O)[O-].CCCCCOCCCCCOC(=O)[O-]
InChIInChI=1S/2C11H22O4.2C8H17.Sn/c2*1-2-3-5-8-14-9-6-4-7-10-15-11(12)13;2*1-3-5-7-8-6-4-2;/h2*2-10H2,1H3,(H,12,13);2*1,3-8H2,2H3;/q;;;;+2/p-2
InChIKeyQYTHUNIYEJCNMF-UHFFFAOYSA-L
MW779.73 g/mol
LogP9.69
Rot. Bonds34

About dioctyltin(2+);bis(5-pentoxypentyl carbonate)

dioctyltin(2+);bis(5-pentoxypentyl carbonate) (PubChem CID 160556550) has the molecular formula C38H76O8Sn and a molecular weight of 779.73 g/mol. Its IUPAC name is dioctyltin(2+);bis(5-pentoxypentyl carbonate).

Molecular Properties

Compound Namedioctyltin(2+);bis(5-pentoxypentyl carbonate)
PubChem CID160556550
Molecular FormulaC38H76O8Sn
Molecular Weight779.73 g/mol
Exact Mass780.46
IUPAC Namedioctyltin(2+);bis(5-pentoxypentyl carbonate)
SMILESCCCCCCCC[Sn+2]CCCCCCCC.CCCCCOCCCCCOC(=O)[O-].CCCCCOCCCCCOC(=O)[O-]
InChIInChI=1S/2C11H22O4.2C8H17.Sn/c2*1-2-3-5-8-14-9-6-4-7-10-15-11(12)13;2*1-3-5-7-8-6-4-2;/h2*2-10H2,1H3,(H,12,13);2*1,3-8H2,2H3;/q;;;;+2/p-2
InChIKeyQYTHUNIYEJCNMF-UHFFFAOYSA-L
XLogP9.69
TPSA117.18 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds34
Heavy Atoms47
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500779.73
LogP ≤ 59.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze dioctyltin(2+);bis(5-pentoxypentyl carbonate) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dioctyltin(2+);bis(5-pentoxypentyl carbonate)?
The IUPAC name of dioctyltin(2+);bis(5-pentoxypentyl carbonate) (CID 160556550) is dioctyltin(2+);bis(5-pentoxypentyl carbonate).
What is the SMILES notation for dioctyltin(2+);bis(5-pentoxypentyl carbonate)?
The canonical SMILES for dioctyltin(2+);bis(5-pentoxypentyl carbonate) is CCCCCCCC[Sn+2]CCCCCCCC.CCCCCOCCCCCOC(=O)[O-].CCCCCOCCCCCOC(=O)[O-].
What is the InChIKey of dioctyltin(2+);bis(5-pentoxypentyl carbonate)?
The InChIKey is QYTHUNIYEJCNMF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H22O4.2C8H17.Sn/c2*1-2-3-5-8-14-9-6-4-7-10-15-11(12)13;2*1-3-5-7-8-6-4-2;/h2*2-10H2,1H3,(H,12,13);2*1,3-8H2,2H3;/q;;;;+2/p-2.
What are the key properties of dioctyltin(2+);bis(5-pentoxypentyl carbonate)?
dioctyltin(2+);bis(5-pentoxypentyl carbonate) has a molecular weight of 779.73 g/mol, XLogP of 9.69, 34 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+);bis(5-pentoxypentyl carbonate) is sourced from PubChem (CID 160556550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).