About 2-aminoethyl carbonate;copper(1+)
2-aminoethyl carbonate;copper(1+) (PubChem CID 174481265) has the molecular formula C3H6CuNO3
and a molecular weight of 167.63 g/mol. Its IUPAC name is 2-aminoethyl carbonate;copper(1+).
Molecular Properties
| Compound Name | 2-aminoethyl carbonate;copper(1+) |
| PubChem CID | 174481265 |
| Molecular Formula | C3H6CuNO3 |
| Molecular Weight | 167.63 g/mol |
| Exact Mass | 166.96 |
| IUPAC Name | 2-aminoethyl carbonate;copper(1+) |
| SMILES | NCCOC(=O)[O-].[Cu+] |
| InChI | InChI=1S/C3H7NO3.Cu/c4-1-2-7-3(5)6;/h1-2,4H2,(H,5,6);/q;+1/p-1 |
| InChIKey | XSWTXYHSOVCOJR-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.63 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl carbonate;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl carbonate;copper(1+)?
The IUPAC name of 2-aminoethyl carbonate;copper(1+) (CID 174481265) is 2-aminoethyl carbonate;copper(1+).
What is the SMILES notation for 2-aminoethyl carbonate;copper(1+)?
The canonical SMILES for 2-aminoethyl carbonate;copper(1+) is NCCOC(=O)[O-].[Cu+].
What is the InChIKey of 2-aminoethyl carbonate;copper(1+)?
The InChIKey is XSWTXYHSOVCOJR-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO3.Cu/c4-1-2-7-3(5)6;/h1-2,4H2,(H,5,6);/q;+1/p-1.
What are the key properties of 2-aminoethyl carbonate;copper(1+)?
2-aminoethyl carbonate;copper(1+) has a molecular weight of 167.63 g/mol, XLogP of -1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl carbonate;copper(1+) is sourced from PubChem (CID 174481265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).