About magnesium propyl carbonate
magnesium propyl carbonate (PubChem CID 22154995) has the molecular formula C4H7MgO3+
and a molecular weight of 127.40 g/mol. Its IUPAC name is magnesium propyl carbonate.
Molecular Properties
| Compound Name | magnesium propyl carbonate |
| PubChem CID | 22154995 |
| Molecular Formula | C4H7MgO3+ |
| Molecular Weight | 127.40 g/mol |
| Exact Mass | 127.02 |
| IUPAC Name | magnesium propyl carbonate |
| SMILES | CCCOC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C4H8O3.Mg/c1-2-3-7-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+2/p-1 |
| InChIKey | QRXFMVNMTKLHGK-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium propyl carbonate?
The IUPAC name of magnesium propyl carbonate (CID 22154995) is magnesium propyl carbonate.
What is the SMILES notation for magnesium propyl carbonate?
The canonical SMILES for magnesium propyl carbonate is CCCOC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium propyl carbonate?
The InChIKey is QRXFMVNMTKLHGK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O3.Mg/c1-2-3-7-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+2/p-1.
What are the key properties of magnesium propyl carbonate?
magnesium propyl carbonate has a molecular weight of 127.40 g/mol, XLogP of -0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium propyl carbonate is sourced from PubChem (CID 22154995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).