About potassium 2-ethoxy-2-oxoacetate
potassium 2-ethoxy-2-oxoacetate (PubChem CID 23678856) has the molecular formula C4H5KO4
and a molecular weight of 156.18 g/mol. Its IUPAC name is potassium 2-ethoxy-2-oxoacetate.
Molecular Properties
| Compound Name | potassium 2-ethoxy-2-oxoacetate |
| PubChem CID | 23678856 |
| Molecular Formula | C4H5KO4 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 155.98 |
| IUPAC Name | potassium 2-ethoxy-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C4H6O4.K/c1-2-8-4(7)3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | RLPQQBNSTHRHEK-UHFFFAOYSA-M |
| XLogP | -4.70 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-ethoxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-ethoxy-2-oxoacetate?
The IUPAC name of potassium 2-ethoxy-2-oxoacetate (CID 23678856) is potassium 2-ethoxy-2-oxoacetate.
What is the SMILES notation for potassium 2-ethoxy-2-oxoacetate?
The canonical SMILES for potassium 2-ethoxy-2-oxoacetate is CCOC(=O)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-ethoxy-2-oxoacetate?
The InChIKey is RLPQQBNSTHRHEK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O4.K/c1-2-8-4(7)3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of potassium 2-ethoxy-2-oxoacetate?
potassium 2-ethoxy-2-oxoacetate has a molecular weight of 156.18 g/mol, XLogP of -4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-ethoxy-2-oxoacetate is sourced from PubChem (CID 23678856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).