C8H11O5- — CID 4255552
1,4-diethoxy-1,4-dioxobut-2-en-2-olate (PubChem CID 4255552) has the molecular formula C8H11O5- and a molecular weight of 187.17 g/mol. Its IUPAC name is 1,4-diethoxy-1,4-dioxobut-2-en-2-olate.
| Compound Name | 1,4-diethoxy-1,4-dioxobut-2-en-2-olate |
|---|---|
| PubChem CID | 4255552 |
| Molecular Formula | C8H11O5- |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1,4-diethoxy-1,4-dioxobut-2-en-2-olate |
| SMILES | CCOC(=O)C=C([O-])C(=O)OCC |
| InChI | InChI=1S/C8H12O5/c1-3-12-7(10)5-6(9)8(11)13-4-2/h5,9H,3-4H2,1-2H3/p-1 |
| InChIKey | JILRCVQYCFULEY-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|