C13H18NNaO6 — CID 73212107
sodium (2Z,5E)-6-(dimethylamino)-1-ethoxy-5-ethoxycarbonyl-1,4-dioxohexa-2,5-dien-2-olate (PubChem CID 73212107) has the molecular formula C13H18NNaO6 and a molecular weight of 307.28 g/mol. Its IUPAC name is sodium (2Z,5E)-6-(dimethylamino)-1-ethoxy-5-ethoxycarbonyl-1,4-dioxohexa-2,5-dien-2-olate.
| Compound Name | sodium (2Z,5E)-6-(dimethylamino)-1-ethoxy-5-ethoxycarbonyl-1,4-dioxohexa-2,5-dien-2-olate |
|---|---|
| PubChem CID | 73212107 |
| Molecular Formula | C13H18NNaO6 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | sodium (2Z,5E)-6-(dimethylamino)-1-ethoxy-5-ethoxycarbonyl-1,4-dioxohexa-2,5-dien-2-olate |
| SMILES | CCOC(=O)/C([O-])=C/C(=O)/C(=C\N(C)C)C(=O)OCC.[Na+] |
| InChI | InChI=1S/C13H19NO6.Na/c1-5-19-12(17)9(8-14(3)4)10(15)7-11(16)13(18)20-6-2;/h7-8,16H,5-6H2,1-4H3;/q;+1/p-1/b9-8+,11-7-; |
| InChIKey | VWLRBUHLUZPVOF-LAYFAJFLSA-M |
| XLogP | -3.62 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|