C13H23NO5 — CID 123925064
ethyl 2-(dimethylaminomethylidene)-4,4-diethoxy-3-oxobutanoate (PubChem CID 123925064) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 2-(dimethylaminomethylidene)-4,4-diethoxy-3-oxobutanoate.
| Compound Name | ethyl 2-(dimethylaminomethylidene)-4,4-diethoxy-3-oxobutanoate |
|---|---|
| PubChem CID | 123925064 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethyl 2-(dimethylaminomethylidene)-4,4-diethoxy-3-oxobutanoate |
| SMILES | CCOC(=O)C(=CN(C)C)C(=O)C(OCC)OCC |
| InChI | InChI=1S/C13H23NO5/c1-6-17-12(16)10(9-14(4)5)11(15)13(18-7-2)19-8-3/h9,13H,6-8H2,1-5H3 |
| InChIKey | SZFFCEBBQIJXEV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|