C14H12F5NO3 — CID 54558010
ethyl 3-(dimethylamino)-2-(2,3,4,5,6-pentafluorobenzoyl)prop-2-enoate (PubChem CID 54558010) has the molecular formula C14H12F5NO3 and a molecular weight of 337.24 g/mol. Its IUPAC name is ethyl 3-(dimethylamino)-2-(2,3,4,5,6-pentafluorobenzoyl)prop-2-enoate.
| Compound Name | ethyl 3-(dimethylamino)-2-(2,3,4,5,6-pentafluorobenzoyl)prop-2-enoate |
|---|---|
| PubChem CID | 54558010 |
| Molecular Formula | C14H12F5NO3 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | ethyl 3-(dimethylamino)-2-(2,3,4,5,6-pentafluorobenzoyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=CN(C)C)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H12F5NO3/c1-4-23-14(22)6(5-20(2)3)13(21)7-8(15)10(17)12(19)11(18)9(7)16/h5H,4H2,1-3H3 |
| InChIKey | ZONJMEZUGDUMKM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|