C16H17F3O4 — CID 15075820
ethyl (Z)-3-ethoxy-2-(2,4,5-trifluoro-3,6-dimethylbenzoyl)prop-2-enoate (PubChem CID 15075820) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is ethyl (Z)-3-ethoxy-2-(2,4,5-trifluoro-3,6-dimethylbenzoyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-ethoxy-2-(2,4,5-trifluoro-3,6-dimethylbenzoyl)prop-2-enoate |
|---|---|
| PubChem CID | 15075820 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl (Z)-3-ethoxy-2-(2,4,5-trifluoro-3,6-dimethylbenzoyl)prop-2-enoate |
| SMILES | CCO/C=C(\C(=O)OCC)C(=O)c1c(C)c(F)c(F)c(C)c1F |
| InChI | InChI=1S/C16H17F3O4/c1-5-22-7-10(16(21)23-6-2)15(20)11-8(3)13(18)14(19)9(4)12(11)17/h7H,5-6H2,1-4H3/b10-7- |
| InChIKey | KOXMGBSVFICWKS-YFHOEESVSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|