C12H10Cl2FNO4 — CID 87890530
(Z)-2-(2,6-dichloro-5-fluoro-4-methylpyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid (PubChem CID 87890530) has the molecular formula C12H10Cl2FNO4 and a molecular weight of 322.12 g/mol. Its IUPAC name is (Z)-2-(2,6-dichloro-5-fluoro-4-methylpyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid.
| Compound Name | (Z)-2-(2,6-dichloro-5-fluoro-4-methylpyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 87890530 |
| Molecular Formula | C12H10Cl2FNO4 |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (Z)-2-(2,6-dichloro-5-fluoro-4-methylpyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid |
| SMILES | CCO/C=C(\C(=O)O)C(=O)c1c(Cl)nc(Cl)c(F)c1C |
| InChI | InChI=1S/C12H10Cl2FNO4/c1-3-20-4-6(12(18)19)9(17)7-5(2)8(15)11(14)16-10(7)13/h4H,3H2,1-2H3,(H,18,19)/b6-4- |
| InChIKey | RRYASCNJNAPFIK-XQRVVYSFSA-N |
| XLogP | 3.02 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|