About (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid
(Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid (PubChem CID 87889871) has the molecular formula C11H7Cl2FINO4
and a molecular weight of 433.99 g/mol. Its IUPAC name is (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid |
| PubChem CID | 87889871 |
| Molecular Formula | C11H7Cl2FINO4 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid |
| SMILES | CCO/C=C(\C(=O)O)C(=O)c1c(Cl)nc(Cl)c(F)c1I |
| InChI | InChI=1S/C11H7Cl2FINO4/c1-2-20-3-4(11(18)19)8(17)5-7(15)6(14)10(13)16-9(5)12/h3H,2H2,1H3,(H,18,19)/b4-3- |
| InChIKey | HDONAIDLXBVBFU-ARJAWSKDSA-N |
| XLogP | 3.32 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid?
The IUPAC name of (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid (CID 87889871) is (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid.
What is the SMILES notation for (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid?
The canonical SMILES for (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid is CCO/C=C(\C(=O)O)C(=O)c1c(Cl)nc(Cl)c(F)c1I.
What is the InChIKey of (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid?
The InChIKey is HDONAIDLXBVBFU-ARJAWSKDSA-N. The full InChI is InChI=1S/C11H7Cl2FINO4/c1-2-20-3-4(11(18)19)8(17)5-7(15)6(14)10(13)16-9(5)12/h3H,2H2,1H3,(H,18,19)/b4-3-.
What are the key properties of (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid?
(Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid has a molecular weight of 433.99 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,6-dichloro-5-fluoro-4-iodopyridine-3-carbonyl)-3-ethoxyprop-2-enoic acid is sourced from PubChem (CID 87889871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).