C9H13NO6 — CID 118092145
(Z)-3-ethoxy-2-(ethoxycarbonylcarbamoyl)prop-2-enoic acid (PubChem CID 118092145) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is (Z)-3-ethoxy-2-(ethoxycarbonylcarbamoyl)prop-2-enoic acid.
| Compound Name | (Z)-3-ethoxy-2-(ethoxycarbonylcarbamoyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 118092145 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (Z)-3-ethoxy-2-(ethoxycarbonylcarbamoyl)prop-2-enoic acid |
| SMILES | CCO/C=C(\C(=O)O)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C9H13NO6/c1-3-15-5-6(8(12)13)7(11)10-9(14)16-4-2/h5H,3-4H2,1-2H3,(H,12,13)(H,10,11,14)/b6-5- |
| InChIKey | XOFYYNAYDLYARS-WAYWQWQTSA-N |
| XLogP | 0.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|