About cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate
cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate (PubChem CID 160975753) has the molecular formula C7H12CoN2O5
and a molecular weight of 263.12 g/mol. Its IUPAC name is cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate.
Molecular Properties
| Compound Name | cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate |
| PubChem CID | 160975753 |
| Molecular Formula | C7H12CoN2O5 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate |
| SMILES | CCOC(=O)NC(=O)NC(=O)OCC.[Co] |
| InChI | InChI=1S/C7H12N2O5.Co/c1-3-13-6(11)8-5(10)9-7(12)14-4-2;/h3-4H2,1-2H3,(H2,8,9,10,11,12); |
| InChIKey | SYVOJPMGGBQDGV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate?
The IUPAC name of cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate (CID 160975753) is cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate.
What is the SMILES notation for cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate?
The canonical SMILES for cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate is CCOC(=O)NC(=O)NC(=O)OCC.[Co].
What is the InChIKey of cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate?
The InChIKey is SYVOJPMGGBQDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O5.Co/c1-3-13-6(11)8-5(10)9-7(12)14-4-2;/h3-4H2,1-2H3,(H2,8,9,10,11,12);.
What are the key properties of cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate?
cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate has a molecular weight of 263.12 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;ethyl N-(ethoxycarbonylcarbamoyl)carbamate is sourced from PubChem (CID 160975753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).