C9H20F2N2O12S2 — CID 172774466
ethyl N-(ethoxycarbonylcarbamoyl)carbamate;fluoromethanesulfonic acid;hydrate (PubChem CID 172774466) has the molecular formula C9H20F2N2O12S2 and a molecular weight of 450.39 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylcarbamoyl)carbamate;fluoromethanesulfonic acid;hydrate.
| Compound Name | ethyl N-(ethoxycarbonylcarbamoyl)carbamate;fluoromethanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 172774466 |
| Molecular Formula | C9H20F2N2O12S2 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | ethyl N-(ethoxycarbonylcarbamoyl)carbamate;fluoromethanesulfonic acid;hydrate |
| SMILES | CCOC(=O)NC(=O)NC(=O)OCC.O.O=S(=O)(O)CF.O=S(=O)(O)CF |
| InChI | InChI=1S/C7H12N2O5.2CH3FO3S.H2O/c1-3-13-6(11)8-5(10)9-7(12)14-4-2;2*2-1-6(3,4)5;/h3-4H2,1-2H3,(H2,8,9,10,11,12);2*1H2,(H,3,4,5);1H2 |
| InChIKey | NJXURYUPPLPKGA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 233.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|