C8H14N4O2 — CID 2829864
ethyl N-[1-cyano-2,2-bis(methylamino)ethenyl]carbamate (PubChem CID 2829864) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is ethyl N-[1-cyano-2,2-bis(methylamino)ethenyl]carbamate.
| Compound Name | ethyl N-[1-cyano-2,2-bis(methylamino)ethenyl]carbamate |
|---|---|
| PubChem CID | 2829864 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | ethyl N-[1-cyano-2,2-bis(methylamino)ethenyl]carbamate |
| SMILES | CCOC(=O)NC(C#N)=C(NC)NC |
| InChI | InChI=1S/C8H14N4O2/c1-4-14-8(13)12-6(5-9)7(10-2)11-3/h10-11H,4H2,1-3H3,(H,12,13) |
| InChIKey | CNKNFTLZINMJIJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|