About ethyl 2-cyanoacetate
ethyl 2-cyanoacetate (PubChem CID 13007964) has the molecular formula C5H6NO2+
and a molecular weight of 112.11 g/mol. Its IUPAC name is ethyl 2-cyanoacetate.
Molecular Properties
| Compound Name | ethyl 2-cyanoacetate |
| PubChem CID | 13007964 |
| Molecular Formula | C5H6NO2+ |
| Molecular Weight | 112.11 g/mol |
| Exact Mass | 112.04 |
| IUPAC Name | ethyl 2-cyanoacetate |
| SMILES | CCOC(=O)[CH+]C#N |
| InChI | InChI=1S/C5H6NO2/c1-2-8-5(7)3-4-6/h3H,2H2,1H3/q+1 |
| InChIKey | MKCBKKWOUAGDLN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyanoacetate?
The IUPAC name of ethyl 2-cyanoacetate (CID 13007964) is ethyl 2-cyanoacetate.
What is the SMILES notation for ethyl 2-cyanoacetate?
The canonical SMILES for ethyl 2-cyanoacetate is CCOC(=O)[CH+]C#N.
What is the InChIKey of ethyl 2-cyanoacetate?
The InChIKey is MKCBKKWOUAGDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6NO2/c1-2-8-5(7)3-4-6/h3H,2H2,1H3/q+1.
What are the key properties of ethyl 2-cyanoacetate?
ethyl 2-cyanoacetate has a molecular weight of 112.11 g/mol, XLogP of 0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyanoacetate is sourced from PubChem (CID 13007964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).