About bis(acetonitrile);ethyl acetate
bis(acetonitrile);ethyl acetate (PubChem CID 87902691) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is bis(acetonitrile);ethyl acetate.
Molecular Properties
| Compound Name | bis(acetonitrile);ethyl acetate |
| PubChem CID | 87902691 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | bis(acetonitrile);ethyl acetate |
| SMILES | CC#N.CC#N.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.2C2H3N/c1-3-6-4(2)5;2*1-2-3/h3H2,1-2H3;2*1H3 |
| InChIKey | QLSYIEGOUWSMMQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(acetonitrile);ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);ethyl acetate?
The IUPAC name of bis(acetonitrile);ethyl acetate (CID 87902691) is bis(acetonitrile);ethyl acetate.
What is the SMILES notation for bis(acetonitrile);ethyl acetate?
The canonical SMILES for bis(acetonitrile);ethyl acetate is CC#N.CC#N.CCOC(C)=O.
What is the InChIKey of bis(acetonitrile);ethyl acetate?
The InChIKey is QLSYIEGOUWSMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.2C2H3N/c1-3-6-4(2)5;2*1-2-3/h3H2,1-2H3;2*1H3.
What are the key properties of bis(acetonitrile);ethyl acetate?
bis(acetonitrile);ethyl acetate has a molecular weight of 170.21 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);ethyl acetate is sourced from PubChem (CID 87902691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).