About but-2-yne;ethyl acetate
but-2-yne;ethyl acetate (PubChem CID 175723988) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is but-2-yne;ethyl acetate.
Molecular Properties
| Compound Name | but-2-yne;ethyl acetate |
| PubChem CID | 175723988 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | but-2-yne;ethyl acetate |
| SMILES | CC#CC.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.C4H6/c1-3-6-4(2)5;1-3-4-2/h3H2,1-2H3;1-2H3 |
| InChIKey | RKRWPNRQEMWMQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-yne;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-yne;ethyl acetate?
The IUPAC name of but-2-yne;ethyl acetate (CID 175723988) is but-2-yne;ethyl acetate.
What is the SMILES notation for but-2-yne;ethyl acetate?
The canonical SMILES for but-2-yne;ethyl acetate is CC#CC.CCOC(C)=O.
What is the InChIKey of but-2-yne;ethyl acetate?
The InChIKey is RKRWPNRQEMWMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C4H6/c1-3-6-4(2)5;1-3-4-2/h3H2,1-2H3;1-2H3.
What are the key properties of but-2-yne;ethyl acetate?
but-2-yne;ethyl acetate has a molecular weight of 142.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;ethyl acetate is sourced from PubChem (CID 175723988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).